- Chemical Name 1-[4-(acetylamino)-3-chlorophenyl]-3-methyl-1H-1,2,4-triazolium methyl sulphate
- CAS No. 71501-35-4
- Contact Us Inquiry
Manufacturer supply top purity 1-[4-(acetylamino)-3-chlorophenyl]-3-methyl-1H-1,2,4-triazolium methyl sulphate 71501-35-4 with ISO standards
- Molecular Formula: C12H15ClN4O5S
- Molecular Weight: 362.7893
- PSA： 135.28000
- LogP: 3.35340
1-[4-(acetylamino)-3-chlorophenyl]-3-methyl-1H-1,2,4-triazolium methyl sulphate(Cas 71501-35-4) Usage
|
Chemical class |
1,2,4-triazole derivatives |
|
Core structure |
1,2,4-triazolium |
|
Attached groups |
a. Methyl sulphate group
|
|
Potential applications |
a. Pharmaceuticals
|
|
Unique structure |
Interesting for further research and development |
|
General Description |
1-[4-(acetylamino)-3-chlorophenyl]-3-methyl-1H-1,2,4-triazolium methyl sulphate is a chemical compound that belongs to the class of 1,2,4-triazole derivatives. It consists of a 1,2,4-triazolium core with a methyl sulphate group attached to it. Additionally, there is a 3-methyl group and a 4-(acetylamino)-3-chlorophenyl group attached to the triazolium core. 1-[4-(acetylamino)-3-chlorophenyl]-3-methyl-1H-1,2,4-triazolium methyl sulphate has potential applications in various fields including pharmaceuticals, agrochemicals, and materials science. Its unique structure and properties make it interesting for further research and development. |
InChI:InChI=1/C11H11ClN4O.CH4O4S/c1-7-13-6-16(15-7)9-3-4-11(10(12)5-9)14-8(2)17;1-5-6(2,3)4/h3-6H,1-2H3,(H,14,17);1H3,(H,2,3,4)