What is the 2-Furancarboxylic acid?

2-Furancarboxylic acid is , while it's Molecular Formula is C5H4 O3. Used in Pharmaceutical Industry: 2-Furancarboxylic acid is used as a key intermediate for the synthesis of various pharmaceuticals, contributing to the development of new drugs and therapeutic agents. Its unique chemical structure allows for the creation of a wide range of medicinal compounds with potential health benefits. Used in Agrochemical Industry: In the agrochemical sector, 2-Furancarboxylic acid serves as a precursor for the production of various agrochemicals, including pesticides and herbicides. Its role in these applications is crucial for enhancing crop protection and ensuring agricultural productivity. Used in Organic Material Synthesis: 2-Furancarboxylic acid is utilized as a building block in the synthesis of organic materials, such as polymers and resins. Its incorporation into these materials can improve their properties, such as strength, durability, and resistance to environmental factors. Used in Bio-based Materials Development: Due to its renewable and sustainable nature, 2-Furancarboxylic acid is used in the development of bio-based materials, which are increasingly sought after as alternatives to petroleum-based products. These materials can be used in various industries, including packaging, textiles, and construction, to reduce environmental impact. Used in Green Chemistry: 2-Furancarboxylic acid plays a significant role in green chemistry, where it is employed in the synthesis of environmentally friendly chemicals. Its use in this field helps to reduce the reliance on hazardous substances and promote sustainable chemical processes.

What is the CAS number for 2-Furancarboxylic acid?

The CAS number of 2-Furancarboxylic acid is 26447-28-9.

What is the 2-Furancarboxylic acid?

2-Furancarboxylic acid is , while it's Molecular Formula is C5H4 O3. Used in Pharmaceutical Industry: 2-Furancarboxylic acid is used as a key intermediate for the synthesis of various pharmaceuticals, contributing to the development of new drugs and therapeutic agents. Its unique chemical structure allows for the creation of a wide range of medicinal compounds with potential health benefits. Used in Agrochemical Industry: In the agrochemical sector, 2-Furancarboxylic acid serves as a precursor for the production of various agrochemicals, including pesticides and herbicides. Its role in these applications is crucial for enhancing crop protection and ensuring agricultural productivity. Used in Organic Material Synthesis: 2-Furancarboxylic acid is utilized as a building block in the synthesis of organic materials, such as polymers and resins. Its incorporation into these materials can improve their properties, such as strength, durability, and resistance to environmental factors. Used in Bio-based Materials Development: Due to its renewable and sustainable nature, 2-Furancarboxylic acid is used in the development of bio-based materials, which are increasingly sought after as alternatives to petroleum-based products. These materials can be used in various industries, including packaging, textiles, and construction, to reduce environmental impact. Used in Green Chemistry: 2-Furancarboxylic acid plays a significant role in green chemistry, where it is employed in the synthesis of environmentally friendly chemicals. Its use in this field helps to reduce the reliance on hazardous substances and promote sustainable chemical processes.

What is the CAS number for 2-Furancarboxylic acid?

The CAS number of 2-Furancarboxylic acid is 26447-28-9.

Reliable factory customized supply 2-Furancarboxylic acid 26447-28-9

Q: What is 2-Furancarboxylic acid (26447-28-9) used for?

2-Furancarboxylic acid, with the molecular formula C5H4O3, is a key organic compound that features a furan ring with a carboxylic acid group. It is recognized for its diverse properties and is widely used as a precursor in the synthesis of pharmaceuticals, agrochemicals, and organic materials. 2-Furancarboxylic acid can be synthesized through the oxidation of furfural or by the decarboxylation of 5-hydroxymethylfurfural. Its renewable and sustainable nature also positions it as a promising candidate for the development of bio-based materials and green chemicals, making it a versatile compound with extensive applications across the chemical industry.InChI:InChI=1/C5H4O3/c6-5(7)4-2-1-3-8-4/h1-3H,(H,6,7)

Home > Pharmaceutical

Chemical Name 2-Furancarboxylic acid
CAS No. 26447-28-9
Contact Us Inquiry

Reliable factory customized supply 2-Furancarboxylic acid 26447-28-9

Molecular Formula: C5H4 O3
Molecular Weight: 112.09
Vapor Pressure: 0.033mmHg at 25°C
Boiling Point: 271.1°Cat760mmHg
Flash Point: 117.8°C
PSA： 50.44000
Density: 1.401g/cm³
LogP: 0.97780

2-Furancarboxylic acid(Cas 26447-28-9) Usage

General Description

2-Furancarboxylic acid is a key chemical compound with the molecular formula C5H4O3. It is a organic compound containing a furan ring with a carboxylic acid group, and it is generally used as a precursor for the synthesis of various pharmaceuticals, agrochemicals, and organic materials. 2-Furancarboxylic acid can be synthesized through the oxidation of furfural or by the decarboxylation of 5-hydroxymethylfurfural. It exhibits diverse properties and can be used in the production of various polymers and resins. Additionally, 2-furancarboxylic acid has potential applications in the development of bio-based materials and green chemicals due to its renewable and sustainable nature. Overall, 2-furancarboxylic acid is a versatile compound with a wide range of applications in the chemical industry.

InChI:InChI=1/C5H4O3/c6-5(7)4-2-1-3-8-4/h1-3H,(H,6,7)

Home

Company Introduction

Product Center

Pharmaceutical

Organic Chemicals

Agrochemicals

Others

Industry News

Get in Touch

Reliable factory customized supply 2-Furancarboxylic acid 26447-28-9

2-Furancarboxylic acid(Cas 26447-28-9) Usage

Related products